ChemNet > CAS > 4923-87-9;133150-64-8 5-Bromobenzo[b]thiophene
4923-87-9;133150-64-8 5-Bromobenzo[b]thiophene
termék neve |
5-Bromobenzo[b]thiophene |
Szinonimák |
5-Bromothianaphthene; 5-bromo-1-benzothiophene; 5-Bromobenzo[b]thioophene; 5-Bromobenzothiophene; ; BUTTPARK 98\04-80; Benzo[c]thiophene, 5-bromo- |
MF |
C8H5BrS |
Molekulatömeg |
213.0943 |
InChI |
InChI=1/C8H5BrS/c9-7-1-2-8-6(5-7)3-4-10-8/h1-5H |
CAS-szám |
4923-87-9;133150-64-8 |
Molekuláris szerkezete |
|
Sűrűség |
1.649g/cm3 |
Olvadáspont |
46℃ |
Forráspont |
284.7°C at 760 mmHg |
Törésmutató |
1.704 |
Gyulladáspont |
126°C |
Veszély szimbólumok |
Xi:Irritant;
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|